C11H13ClFNO4S — CID 81461252
5-(tert-butylsulfamoyl)-2-chloro-3-fluorobenzoic acid (PubChem CID 81461252) has the molecular formula C11H13ClFNO4S and a molecular weight of 309.75 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-2-chloro-3-fluorobenzoic acid.
| Compound Name | 5-(tert-butylsulfamoyl)-2-chloro-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 81461252 |
| Molecular Formula | C11H13ClFNO4S |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-2-chloro-3-fluorobenzoic acid |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(F)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H13ClFNO4S/c1-11(2,3)14-19(17,18)6-4-7(10(15)16)9(12)8(13)5-6/h4-5,14H,1-3H3,(H,15,16) |
| InChIKey | ULEGMNFVDLRLPZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |