C11H11ClFNO6S — CID 81452105
2-chloro-5-[(2-ethoxy-2-oxoethyl)sulfamoyl]-3-fluorobenzoic acid (PubChem CID 81452105) has the molecular formula C11H11ClFNO6S and a molecular weight of 339.73 g/mol. Its IUPAC name is 2-chloro-5-[(2-ethoxy-2-oxoethyl)sulfamoyl]-3-fluorobenzoic acid.
| Compound Name | 2-chloro-5-[(2-ethoxy-2-oxoethyl)sulfamoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 81452105 |
| Molecular Formula | C11H11ClFNO6S |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2-chloro-5-[(2-ethoxy-2-oxoethyl)sulfamoyl]-3-fluorobenzoic acid |
| SMILES | CCOC(=O)CNS(=O)(=O)c1cc(F)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H11ClFNO6S/c1-2-20-9(15)5-14-21(18,19)6-3-7(11(16)17)10(12)8(13)4-6/h3-4,14H,2,5H2,1H3,(H,16,17) |
| InChIKey | GEPWMZIQGJKERK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |