C11H15FN2O5S — CID 114625222
ethyl 2-[(3-amino-5-fluoro-4-methoxyphenyl)sulfonylamino]acetate (PubChem CID 114625222) has the molecular formula C11H15FN2O5S and a molecular weight of 306.32 g/mol. Its IUPAC name is ethyl 2-[(3-amino-5-fluoro-4-methoxyphenyl)sulfonylamino]acetate.
| Compound Name | ethyl 2-[(3-amino-5-fluoro-4-methoxyphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 114625222 |
| Molecular Formula | C11H15FN2O5S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | ethyl 2-[(3-amino-5-fluoro-4-methoxyphenyl)sulfonylamino]acetate |
| SMILES | CCOC(=O)CNS(=O)(=O)c1cc(N)c(OC)c(F)c1 |
| InChI | InChI=1S/C11H15FN2O5S/c1-3-19-10(15)6-14-20(16,17)7-4-8(12)11(18-2)9(13)5-7/h4-5,14H,3,6,13H2,1-2H3 |
| InChIKey | INMSOLYYZPDFMH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|