C9H14FN3O5S2 — CID 114625133
3-amino-5-fluoro-4-methoxy-N-(2-sulfamoylethyl)benzenesulfonamide (PubChem CID 114625133) has the molecular formula C9H14FN3O5S2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 3-amino-5-fluoro-4-methoxy-N-(2-sulfamoylethyl)benzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-4-methoxy-N-(2-sulfamoylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114625133 |
| Molecular Formula | C9H14FN3O5S2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-amino-5-fluoro-4-methoxy-N-(2-sulfamoylethyl)benzenesulfonamide |
| SMILES | COc1c(N)cc(S(=O)(=O)NCCS(N)(=O)=O)cc1F |
| InChI | InChI=1S/C9H14FN3O5S2/c1-18-9-7(10)4-6(5-8(9)11)20(16,17)13-2-3-19(12,14)15/h4-5,13H,2-3,11H2,1H3,(H2,12,14,15) |
| InChIKey | RLMRTOIDQZDQMM-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|