C12H19FN2O4S2 — CID 106308791
3-amino-5-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 106308791) has the molecular formula C12H19FN2O4S2 and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 106308791 |
| Molecular Formula | C12H19FN2O4S2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-amino-5-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1c(N)cc(S(=O)(=O)NCCSCCCO)cc1F |
| InChI | InChI=1S/C12H19FN2O4S2/c1-19-12-10(13)7-9(8-11(12)14)21(17,18)15-3-6-20-5-2-4-16/h7-8,15-16H,2-6,14H2,1H3 |
| InChIKey | GSZHSKGHDFDTRK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|