C11H16BrFN2O3S2 — CID 106308718
2-amino-5-bromo-4-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 106308718) has the molecular formula C11H16BrFN2O3S2 and a molecular weight of 387.30 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106308718 |
| Molecular Formula | C11H16BrFN2O3S2 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc(F)c(Br)cc1S(=O)(=O)NCCSCCCO |
| InChI | InChI=1S/C11H16BrFN2O3S2/c12-8-6-11(10(14)7-9(8)13)20(17,18)15-2-5-19-4-1-3-16/h6-7,15-16H,1-5,14H2 |
| InChIKey | YVZGSIWBVKSQJK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|