C11H17FN2O3S2 — CID 106308765
2-amino-4-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 106308765) has the molecular formula C11H17FN2O3S2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-4-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106308765 |
| Molecular Formula | C11H17FN2O3S2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-amino-4-fluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | Nc1cc(F)ccc1S(=O)(=O)NCCSCCCO |
| InChI | InChI=1S/C11H17FN2O3S2/c12-9-2-3-11(10(13)8-9)19(16,17)14-4-7-18-6-1-5-15/h2-3,8,14-15H,1,4-7,13H2 |
| InChIKey | QNPGWARDTOBWQB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|