C11H15F2NO3S2 — CID 103834827
2,6-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 103834827) has the molecular formula C11H15F2NO3S2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103834827 |
| Molecular Formula | C11H15F2NO3S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2,6-difluoro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCSCCCO)c1c(F)cccc1F |
| InChI | InChI=1S/C11H15F2NO3S2/c12-9-3-1-4-10(13)11(9)19(16,17)14-5-8-18-7-2-6-15/h1,3-4,14-15H,2,5-8H2 |
| InChIKey | XPTBURJPVUVIAD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|