C13H19NO4S2 — CID 103834850
3-acetyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 103834850) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-acetyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 3-acetyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103834850 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-acetyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NCCSCCCO)c1 |
| InChI | InChI=1S/C13H19NO4S2/c1-11(16)12-4-2-5-13(10-12)20(17,18)14-6-9-19-8-3-7-15/h2,4-5,10,14-15H,3,6-9H2,1H3 |
| InChIKey | ZRBVYRVBZYLMLS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|