C12H19NO5S3 — CID 103834805
N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 103834805) has the molecular formula C12H19NO5S3 and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 103834805 |
| Molecular Formula | C12H19NO5S3 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)NCCSCCCO)cc1 |
| InChI | InChI=1S/C12H19NO5S3/c1-20(15,16)11-3-5-12(6-4-11)21(17,18)13-7-10-19-9-2-8-14/h3-6,13-14H,2,7-10H2,1H3 |
| InChIKey | JNXRIZMBHOLOCU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|