C11H15BrClNO3S2 — CID 114269329
2-bromo-6-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide (PubChem CID 114269329) has the molecular formula C11H15BrClNO3S2 and a molecular weight of 388.74 g/mol. Its IUPAC name is 2-bromo-6-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide.
| Compound Name | 2-bromo-6-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114269329 |
| Molecular Formula | C11H15BrClNO3S2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 386.94 |
| IUPAC Name | 2-bromo-6-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCSCCCO)c1c(Cl)cccc1Br |
| InChI | InChI=1S/C11H15BrClNO3S2/c12-9-3-1-4-10(13)11(9)19(16,17)14-5-8-18-7-2-6-15/h1,3-4,14-15H,2,5-8H2 |
| InChIKey | KADYGHTYYKOAMN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|