C9H14BrNO3S3 — CID 103834752
3-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-2-sulfonamide (PubChem CID 103834752) has the molecular formula C9H14BrNO3S3 and a molecular weight of 360.32 g/mol. Its IUPAC name is 3-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103834752 |
| Molecular Formula | C9H14BrNO3S3 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 358.93 |
| IUPAC Name | 3-bromo-N-[2-(3-hydroxypropylsulfanyl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCSCCCO)c1sccc1Br |
| InChI | InChI=1S/C9H14BrNO3S3/c10-8-2-6-16-9(8)17(13,14)11-3-7-15-5-1-4-12/h2,6,11-12H,1,3-5,7H2 |
| InChIKey | XKTDCONRHGGSHC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|