C10H16BrNO3S2 — CID 103858901
3-bromo-N-(5-hydroxy-4-methylpentyl)thiophene-2-sulfonamide (PubChem CID 103858901) has the molecular formula C10H16BrNO3S2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 3-bromo-N-(5-hydroxy-4-methylpentyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(5-hydroxy-4-methylpentyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103858901 |
| Molecular Formula | C10H16BrNO3S2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 3-bromo-N-(5-hydroxy-4-methylpentyl)thiophene-2-sulfonamide |
| SMILES | CC(CO)CCCNS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C10H16BrNO3S2/c1-8(7-13)3-2-5-12-17(14,15)10-9(11)4-6-16-10/h4,6,8,12-13H,2-3,5,7H2,1H3 |
| InChIKey | HBQBBVRWJUHXDG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|