C11H15BrN2O3S2 — CID 112732422
4-[(3-bromothiophen-2-yl)sulfonylamino]-N-cyclopropylbutanamide (PubChem CID 112732422) has the molecular formula C11H15BrN2O3S2 and a molecular weight of 367.29 g/mol. Its IUPAC name is 4-[(3-bromothiophen-2-yl)sulfonylamino]-N-cyclopropylbutanamide.
| Compound Name | 4-[(3-bromothiophen-2-yl)sulfonylamino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 112732422 |
| Molecular Formula | C11H15BrN2O3S2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 4-[(3-bromothiophen-2-yl)sulfonylamino]-N-cyclopropylbutanamide |
| SMILES | O=C(CCCNS(=O)(=O)c1sccc1Br)NC1CC1 |
| InChI | InChI=1S/C11H15BrN2O3S2/c12-9-5-7-18-11(9)19(16,17)13-6-1-2-10(15)14-8-3-4-8/h5,7-8,13H,1-4,6H2,(H,14,15) |
| InChIKey | UZMWQVASHMDIJL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|