C13H16BrFN2O3S — CID 116528718
4-[(4-bromo-2-fluorophenyl)sulfonylamino]-N-cyclopropylbutanamide (PubChem CID 116528718) has the molecular formula C13H16BrFN2O3S and a molecular weight of 379.25 g/mol. Its IUPAC name is 4-[(4-bromo-2-fluorophenyl)sulfonylamino]-N-cyclopropylbutanamide.
| Compound Name | 4-[(4-bromo-2-fluorophenyl)sulfonylamino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 116528718 |
| Molecular Formula | C13H16BrFN2O3S |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 4-[(4-bromo-2-fluorophenyl)sulfonylamino]-N-cyclopropylbutanamide |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc(Br)cc1F)NC1CC1 |
| InChI | InChI=1S/C13H16BrFN2O3S/c14-9-3-6-12(11(15)8-9)21(19,20)16-7-1-2-13(18)17-10-4-5-10/h3,6,8,10,16H,1-2,4-5,7H2,(H,17,18) |
| InChIKey | BPPNAQCJVUWXOG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|