C15H18F2N2O5S — CID 8537264
[2-(cyclopropylamino)-2-oxoethyl] 4-[(2,4-difluorophenyl)sulfonylamino]butanoate (PubChem CID 8537264) has the molecular formula C15H18F2N2O5S and a molecular weight of 376.38 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 4-[(2,4-difluorophenyl)sulfonylamino]butanoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 4-[(2,4-difluorophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 8537264 |
| Molecular Formula | C15H18F2N2O5S |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 4-[(2,4-difluorophenyl)sulfonylamino]butanoate |
| SMILES | O=C(COC(=O)CCCNS(=O)(=O)c1ccc(F)cc1F)NC1CC1 |
| InChI | InChI=1S/C15H18F2N2O5S/c16-10-3-6-13(12(17)8-10)25(22,23)18-7-1-2-15(21)24-9-14(20)19-11-4-5-11/h3,6,8,11,18H,1-2,4-5,7,9H2,(H,19,20) |
| InChIKey | CCNFRVDYQVBWMM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|