C14H19F2NO4S — CID 3577998
tert-butyl 4-[(2,4-difluorophenyl)sulfonylamino]butanoate (PubChem CID 3577998) has the molecular formula C14H19F2NO4S and a molecular weight of 335.37 g/mol. Its IUPAC name is tert-butyl 4-[(2,4-difluorophenyl)sulfonylamino]butanoate.
| Compound Name | tert-butyl 4-[(2,4-difluorophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 3577998 |
| Molecular Formula | C14H19F2NO4S |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | tert-butyl 4-[(2,4-difluorophenyl)sulfonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H19F2NO4S/c1-14(2,3)21-13(18)5-4-8-17-22(19,20)12-7-6-10(15)9-11(12)16/h6-7,9,17H,4-5,8H2,1-3H3 |
| InChIKey | QEHWWOJPEGLUEJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|