C11H13BrFNO4S — CID 61060420
methyl 4-[(2-bromo-4-fluorophenyl)sulfonylamino]butanoate (PubChem CID 61060420) has the molecular formula C11H13BrFNO4S and a molecular weight of 354.20 g/mol. Its IUPAC name is methyl 4-[(2-bromo-4-fluorophenyl)sulfonylamino]butanoate.
| Compound Name | methyl 4-[(2-bromo-4-fluorophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 61060420 |
| Molecular Formula | C11H13BrFNO4S |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | methyl 4-[(2-bromo-4-fluorophenyl)sulfonylamino]butanoate |
| SMILES | COC(=O)CCCNS(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H13BrFNO4S/c1-18-11(15)3-2-6-14-19(16,17)10-5-4-8(13)7-9(10)12/h4-5,7,14H,2-3,6H2,1H3 |
| InChIKey | CRIAPETUGMLHKZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|