C10H11BrFNO5S — CID 79457271
2-[2-[(2-bromo-4-fluorophenyl)sulfonylamino]ethoxy]acetic acid (PubChem CID 79457271) has the molecular formula C10H11BrFNO5S and a molecular weight of 356.17 g/mol. Its IUPAC name is 2-[2-[(2-bromo-4-fluorophenyl)sulfonylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(2-bromo-4-fluorophenyl)sulfonylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79457271 |
| Molecular Formula | C10H11BrFNO5S |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 2-[2-[(2-bromo-4-fluorophenyl)sulfonylamino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNS(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C10H11BrFNO5S/c11-8-5-7(12)1-2-9(8)19(16,17)13-3-4-18-6-10(14)15/h1-2,5,13H,3-4,6H2,(H,14,15) |
| InChIKey | AIIITVVZLGQZAU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|