C11H13F2NO5S — CID 69319429
2-[2-[(2,5-difluorophenyl)sulfonylmethylamino]ethoxy]acetic acid (PubChem CID 69319429) has the molecular formula C11H13F2NO5S and a molecular weight of 309.29 g/mol. Its IUPAC name is 2-[2-[(2,5-difluorophenyl)sulfonylmethylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(2,5-difluorophenyl)sulfonylmethylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 69319429 |
| Molecular Formula | C11H13F2NO5S |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[2-[(2,5-difluorophenyl)sulfonylmethylamino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNCS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H13F2NO5S/c12-8-1-2-9(13)10(5-8)20(17,18)7-14-3-4-19-6-11(15)16/h1-2,5,14H,3-4,6-7H2,(H,15,16) |
| InChIKey | SSILVJNJCGCCEF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|