C8H7F2NO5S — CID 60661324
2-[(2,4-difluorophenyl)sulfonylamino]oxyacetic acid (PubChem CID 60661324) has the molecular formula C8H7F2NO5S and a molecular weight of 267.21 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)sulfonylamino]oxyacetic acid.
| Compound Name | 2-[(2,4-difluorophenyl)sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60661324 |
| Molecular Formula | C8H7F2NO5S |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | 2-[(2,4-difluorophenyl)sulfonylamino]oxyacetic acid |
| SMILES | O=C(O)CONS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C8H7F2NO5S/c9-5-1-2-7(6(10)3-5)17(14,15)11-16-4-8(12)13/h1-3,11H,4H2,(H,12,13) |
| InChIKey | NNWADLIPWFVNQK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|