C9H8F3NO5S — CID 60661367
2-[[2-(trifluoromethyl)phenyl]sulfonylamino]oxyacetic acid (PubChem CID 60661367) has the molecular formula C9H8F3NO5S and a molecular weight of 299.23 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)phenyl]sulfonylamino]oxyacetic acid.
| Compound Name | 2-[[2-(trifluoromethyl)phenyl]sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60661367 |
| Molecular Formula | C9H8F3NO5S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-[[2-(trifluoromethyl)phenyl]sulfonylamino]oxyacetic acid |
| SMILES | O=C(O)CONS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO5S/c10-9(11,12)6-3-1-2-4-7(6)19(16,17)13-18-5-8(14)15/h1-4,13H,5H2,(H,14,15) |
| InChIKey | XDTTXLXHSSGPMI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|