C14H11F3N2O3S — CID 26966737
N'-[2-(trifluoromethyl)phenyl]sulfonylbenzohydrazide (PubChem CID 26966737) has the molecular formula C14H11F3N2O3S and a molecular weight of 344.31 g/mol. Its IUPAC name is N'-[2-(trifluoromethyl)phenyl]sulfonylbenzohydrazide.
| Compound Name | N'-[2-(trifluoromethyl)phenyl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 26966737 |
| Molecular Formula | C14H11F3N2O3S |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N'-[2-(trifluoromethyl)phenyl]sulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H11F3N2O3S/c15-14(16,17)11-8-4-5-9-12(11)23(21,22)19-18-13(20)10-6-2-1-3-7-10/h1-9,19H,(H,18,20) |
| InChIKey | RJUBEQINLMSMRC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|