C13H11BrF3N3O3S — CID 17487267
4-bromo-1-methyl-N'-[2-(trifluoromethyl)phenyl]sulfonylpyrrole-2-carbohydrazide (PubChem CID 17487267) has the molecular formula C13H11BrF3N3O3S and a molecular weight of 426.21 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-[2-(trifluoromethyl)phenyl]sulfonylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-[2-(trifluoromethyl)phenyl]sulfonylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 17487267 |
| Molecular Formula | C13H11BrF3N3O3S |
| Molecular Weight | 426.21 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | 4-bromo-1-methyl-N'-[2-(trifluoromethyl)phenyl]sulfonylpyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H11BrF3N3O3S/c1-20-7-8(14)6-10(20)12(21)18-19-24(22,23)11-5-3-2-4-9(11)13(15,16)17/h2-7,19H,1H3,(H,18,21) |
| InChIKey | KTHDSVRATCPVFN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|