C10H11FN2O6S — CID 60748669
2-[(4-acetamido-2-fluorophenyl)sulfonylamino]oxyacetic acid (PubChem CID 60748669) has the molecular formula C10H11FN2O6S and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-[(4-acetamido-2-fluorophenyl)sulfonylamino]oxyacetic acid.
| Compound Name | 2-[(4-acetamido-2-fluorophenyl)sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60748669 |
| Molecular Formula | C10H11FN2O6S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-[(4-acetamido-2-fluorophenyl)sulfonylamino]oxyacetic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NOCC(=O)O)c(F)c1 |
| InChI | InChI=1S/C10H11FN2O6S/c1-6(14)12-7-2-3-9(8(11)4-7)20(17,18)13-19-5-10(15)16/h2-4,13H,5H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | ASVCDGKLNWBGRC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|