C15H13FN2O6S — CID 167825514
4-[(4-acetamido-2-fluorophenyl)sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 167825514) has the molecular formula C15H13FN2O6S and a molecular weight of 368.34 g/mol. Its IUPAC name is 4-[(4-acetamido-2-fluorophenyl)sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-acetamido-2-fluorophenyl)sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 167825514 |
| Molecular Formula | C15H13FN2O6S |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 4-[(4-acetamido-2-fluorophenyl)sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(C(=O)O)c(O)c2)c(F)c1 |
| InChI | InChI=1S/C15H13FN2O6S/c1-8(19)17-9-3-5-14(12(16)6-9)25(23,24)18-10-2-4-11(15(21)22)13(20)7-10/h2-7,18,20H,1H3,(H,17,19)(H,21,22) |
| InChIKey | AQTKWQXPAQARAY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |