C13H9Cl2NO5S — CID 45330209
4-[(3,5-dichlorophenyl)sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 45330209) has the molecular formula C13H9Cl2NO5S and a molecular weight of 362.19 g/mol. Its IUPAC name is 4-[(3,5-dichlorophenyl)sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3,5-dichlorophenyl)sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 45330209 |
| Molecular Formula | C13H9Cl2NO5S |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 4-[(3,5-dichlorophenyl)sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)cc1O |
| InChI | InChI=1S/C13H9Cl2NO5S/c14-7-3-8(15)5-10(4-7)22(20,21)16-9-1-2-11(13(18)19)12(17)6-9/h1-6,16-17H,(H,18,19) |
| InChIKey | JVQVVSNNCLQCDZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |