C21H19NO7S — CID 56596202
4-[[3-(3,4-dimethoxyphenyl)phenyl]sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 56596202) has the molecular formula C21H19NO7S and a molecular weight of 429.45 g/mol. Its IUPAC name is 4-[[3-(3,4-dimethoxyphenyl)phenyl]sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[3-(3,4-dimethoxyphenyl)phenyl]sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 56596202 |
| Molecular Formula | C21H19NO7S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 4-[[3-(3,4-dimethoxyphenyl)phenyl]sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(-c2cccc(S(=O)(=O)Nc3ccc(C(=O)O)c(O)c3)c2)cc1OC |
| InChI | InChI=1S/C21H19NO7S/c1-28-19-9-6-14(11-20(19)29-2)13-4-3-5-16(10-13)30(26,27)22-15-7-8-17(21(24)25)18(23)12-15/h3-12,22-23H,1-2H3,(H,24,25) |
| InChIKey | FJKMMZNXRIQNQX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |