C19H14ClFN2O6S — CID 56596351
4-[[6-chloro-5-(2-fluoro-3-methoxyphenyl)-3-pyridinyl]sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 56596351) has the molecular formula C19H14ClFN2O6S and a molecular weight of 452.85 g/mol. Its IUPAC name is 4-[[6-chloro-5-(2-fluoro-3-methoxyphenyl)-3-pyridinyl]sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[6-chloro-5-(2-fluoro-3-methoxyphenyl)-3-pyridinyl]sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 56596351 |
| Molecular Formula | C19H14ClFN2O6S |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 4-[[6-chloro-5-(2-fluoro-3-methoxyphenyl)-3-pyridinyl]sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | COc1cccc(-c2cc(S(=O)(=O)Nc3ccc(C(=O)O)c(O)c3)cnc2Cl)c1F |
| InChI | InChI=1S/C19H14ClFN2O6S/c1-29-16-4-2-3-12(17(16)21)14-8-11(9-22-18(14)20)30(27,28)23-10-5-6-13(19(25)26)15(24)7-10/h2-9,23-24H,1H3,(H,25,26) |
| InChIKey | COAICQKXMAJONZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|