C18H12ClFN2O5S — CID 56596353
4-[[6-chloro-5-(3-fluorophenyl)-3-pyridinyl]sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 56596353) has the molecular formula C18H12ClFN2O5S and a molecular weight of 422.82 g/mol. Its IUPAC name is 4-[[6-chloro-5-(3-fluorophenyl)-3-pyridinyl]sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[6-chloro-5-(3-fluorophenyl)-3-pyridinyl]sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 56596353 |
| Molecular Formula | C18H12ClFN2O5S |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 4-[[6-chloro-5-(3-fluorophenyl)-3-pyridinyl]sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cnc(Cl)c(-c3cccc(F)c3)c2)cc1O |
| InChI | InChI=1S/C18H12ClFN2O5S/c19-17-15(10-2-1-3-11(20)6-10)8-13(9-21-17)28(26,27)22-12-4-5-14(18(24)25)16(23)7-12/h1-9,22-23H,(H,24,25) |
| InChIKey | QYUUBWDAEZETJL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|