C21H18N2O7S — CID 56596050
2-hydroxy-4-[[3-[4-(methoxycarbonylamino)phenyl]phenyl]sulfonylamino]benzoic acid (PubChem CID 56596050) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is 2-hydroxy-4-[[3-[4-(methoxycarbonylamino)phenyl]phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[3-[4-(methoxycarbonylamino)phenyl]phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 56596050 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-hydroxy-4-[[3-[4-(methoxycarbonylamino)phenyl]phenyl]sulfonylamino]benzoic acid |
| SMILES | COC(=O)Nc1ccc(-c2cccc(S(=O)(=O)Nc3ccc(C(=O)O)c(O)c3)c2)cc1 |
| InChI | InChI=1S/C21H18N2O7S/c1-30-21(27)22-15-7-5-13(6-8-15)14-3-2-4-17(11-14)31(28,29)23-16-9-10-18(20(25)26)19(24)12-16/h2-12,23-24H,1H3,(H,22,27)(H,25,26) |
| InChIKey | YPWXWLGKQILJIQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |