C18H15NO2S — CID 54513984
N,3-diphenylbenzenesulfonamide (PubChem CID 54513984) has the molecular formula C18H15NO2S and a molecular weight of 309.39 g/mol. Its IUPAC name is N,3-diphenylbenzenesulfonamide.
| Compound Name | N,3-diphenylbenzenesulfonamide |
|---|---|
| PubChem CID | 54513984 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N,3-diphenylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H15NO2S/c20-22(21,19-17-11-5-2-6-12-17)18-13-7-10-16(14-18)15-8-3-1-4-9-15/h1-14,19H |
| InChIKey | YLCQPVZBJCLNJG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |