C19H15NO6S — CID 56595847
2-hydroxy-4-[[3-(4-hydroxyphenyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 56595847) has the molecular formula C19H15NO6S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-hydroxy-4-[[3-(4-hydroxyphenyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-hydroxy-4-[[3-(4-hydroxyphenyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 56595847 |
| Molecular Formula | C19H15NO6S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-hydroxy-4-[[3-(4-hydroxyphenyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cccc(-c3ccc(O)cc3)c2)cc1O |
| InChI | InChI=1S/C19H15NO6S/c21-15-7-4-12(5-8-15)13-2-1-3-16(10-13)27(25,26)20-14-6-9-17(19(23)24)18(22)11-14/h1-11,20-22H,(H,23,24) |
| InChIKey | IZYJHPZYZGOUOJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |