C17H17NO5S — CID 53228934
2-hydroxy-4-(3-pyrrolidin-1-ylsulfonylphenyl)benzoic acid (PubChem CID 53228934) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-hydroxy-4-(3-pyrrolidin-1-ylsulfonylphenyl)benzoic acid.
| Compound Name | 2-hydroxy-4-(3-pyrrolidin-1-ylsulfonylphenyl)benzoic acid |
|---|---|
| PubChem CID | 53228934 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-hydroxy-4-(3-pyrrolidin-1-ylsulfonylphenyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cccc(S(=O)(=O)N3CCCC3)c2)cc1O |
| InChI | InChI=1S/C17H17NO5S/c19-16-11-13(6-7-15(16)17(20)21)12-4-3-5-14(10-12)24(22,23)18-8-1-2-9-18/h3-7,10-11,19H,1-2,8-9H2,(H,20,21) |
| InChIKey | DZBOPBDXUWHDOJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |