C17H17NO4S — CID 53218491
2-(4-pyrrolidin-1-ylsulfonylphenyl)benzoic acid (PubChem CID 53218491) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is 2-(4-pyrrolidin-1-ylsulfonylphenyl)benzoic acid.
| Compound Name | 2-(4-pyrrolidin-1-ylsulfonylphenyl)benzoic acid |
|---|---|
| PubChem CID | 53218491 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-(4-pyrrolidin-1-ylsulfonylphenyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H17NO4S/c19-17(20)16-6-2-1-5-15(16)13-7-9-14(10-8-13)23(21,22)18-11-3-4-12-18/h1-2,5-10H,3-4,11-12H2,(H,19,20) |
| InChIKey | DORSSTQNMVQMPE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |