C15H17N3O4S — CID 53222473
5-(4-piperidin-1-ylsulfonylphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 53222473) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is 5-(4-piperidin-1-ylsulfonylphenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(4-piperidin-1-ylsulfonylphenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 53222473 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-(4-piperidin-1-ylsulfonylphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(-c2ccc(S(=O)(=O)N3CCCCC3)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H17N3O4S/c19-14-13(10-16-15(20)17-14)11-4-6-12(7-5-11)23(21,22)18-8-2-1-3-9-18/h4-7,10H,1-3,8-9H2,(H2,16,17,19,20) |
| InChIKey | ZRBWGKVBQPRLEM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |