C24H28N2O5S2 — CID 2802043
2-(azepan-1-ylsulfonyl)-7-piperidin-1-ylsulfonylfluoren-9-one (PubChem CID 2802043) has the molecular formula C24H28N2O5S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 2-(azepan-1-ylsulfonyl)-7-piperidin-1-ylsulfonylfluoren-9-one.
| Compound Name | 2-(azepan-1-ylsulfonyl)-7-piperidin-1-ylsulfonylfluoren-9-one |
|---|---|
| PubChem CID | 2802043 |
| Molecular Formula | C24H28N2O5S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-(azepan-1-ylsulfonyl)-7-piperidin-1-ylsulfonylfluoren-9-one |
| SMILES | O=C1c2cc(S(=O)(=O)N3CCCCCC3)ccc2-c2ccc(S(=O)(=O)N3CCCCC3)cc21 |
| InChI | InChI=1S/C24H28N2O5S2/c27-24-22-16-18(32(28,29)25-12-4-1-2-5-13-25)8-10-20(22)21-11-9-19(17-23(21)24)33(30,31)26-14-6-3-7-15-26/h8-11,16-17H,1-7,12-15H2 |
| InChIKey | PNCMTDIWKKZYFL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |