C11H15NNiO2S3+2 — CID 18781712
nickel(2+);4-piperidin-1-ylsulfonylbenzene-1,2-dithiol (PubChem CID 18781712) has the molecular formula C11H15NNiO2S3+2 and a molecular weight of 348.14 g/mol. Its IUPAC name is nickel(2+);4-piperidin-1-ylsulfonylbenzene-1,2-dithiol.
| Compound Name | nickel(2+);4-piperidin-1-ylsulfonylbenzene-1,2-dithiol |
|---|---|
| PubChem CID | 18781712 |
| Molecular Formula | C11H15NNiO2S3+2 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | nickel(2+);4-piperidin-1-ylsulfonylbenzene-1,2-dithiol |
| SMILES | O=S(=O)(c1ccc(S)c(S)c1)N1CCCCC1.[Ni+2] |
| InChI | InChI=1S/C11H15NO2S3.Ni/c13-17(14,12-6-2-1-3-7-12)9-4-5-10(15)11(16)8-9;/h4-5,8,15-16H,1-3,6-7H2;/q;+2 |
| InChIKey | XPKIBHKFJBVROM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|