C13H18N2O4S2 — CID 5300994
2-(4-piperidin-1-ylsulfonyl-2-sulfanylanilino)acetic acid (PubChem CID 5300994) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(4-piperidin-1-ylsulfonyl-2-sulfanylanilino)acetic acid.
| Compound Name | 2-(4-piperidin-1-ylsulfonyl-2-sulfanylanilino)acetic acid |
|---|---|
| PubChem CID | 5300994 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(4-piperidin-1-ylsulfonyl-2-sulfanylanilino)acetic acid |
| SMILES | O=C(O)CNc1ccc(S(=O)(=O)N2CCCCC2)cc1S |
| InChI | InChI=1S/C13H18N2O4S2/c16-13(17)9-14-11-5-4-10(8-12(11)20)21(18,19)15-6-2-1-3-7-15/h4-5,8,14,20H,1-3,6-7,9H2,(H,16,17) |
| InChIKey | LCKXURNUBNSHRW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|