C13H19NO4S2 — CID 6457455
1-(3-methylsulfonylphenyl)sulfonylazepane (PubChem CID 6457455) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-(3-methylsulfonylphenyl)sulfonylazepane.
| Compound Name | 1-(3-methylsulfonylphenyl)sulfonylazepane |
|---|---|
| PubChem CID | 6457455 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(3-methylsulfonylphenyl)sulfonylazepane |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C13H19NO4S2/c1-19(15,16)12-7-6-8-13(11-12)20(17,18)14-9-4-2-3-5-10-14/h6-8,11H,2-5,9-10H2,1H3 |
| InChIKey | BFNWCCVIGJGYNZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |