C17H24N2O6S2 — CID 16828632
[1-(3-methylsulfonylphenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 16828632) has the molecular formula C17H24N2O6S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is [1-(3-methylsulfonylphenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(3-methylsulfonylphenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 16828632 |
| Molecular Formula | C17H24N2O6S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [1-(3-methylsulfonylphenyl)sulfonylpiperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)N2CCC(C(=O)N3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C17H24N2O6S2/c1-26(21,22)15-3-2-4-16(13-15)27(23,24)19-7-5-14(6-8-19)17(20)18-9-11-25-12-10-18/h2-4,13-14H,5-12H2,1H3 |
| InChIKey | DVLWZYPZUXTUPT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |