C16H24N4O5S — CID 24563909
1-methyl-4-[4-(morpholine-4-carbonyl)piperidin-1-yl]sulfonylpyrrole-2-carboxamide (PubChem CID 24563909) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-methyl-4-[4-(morpholine-4-carbonyl)piperidin-1-yl]sulfonylpyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-[4-(morpholine-4-carbonyl)piperidin-1-yl]sulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 24563909 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-methyl-4-[4-(morpholine-4-carbonyl)piperidin-1-yl]sulfonylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCC(C(=O)N3CCOCC3)CC2)cc1C(N)=O |
| InChI | InChI=1S/C16H24N4O5S/c1-18-11-13(10-14(18)15(17)21)26(23,24)20-4-2-12(3-5-20)16(22)19-6-8-25-9-7-19/h10-12H,2-9H2,1H3,(H2,17,21) |
| InChIKey | RWVIOLRJQMNHNR-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |