C16H24N4O4S — CID 24667159
1-(5-carbamoyl-1-methylpyrrol-3-yl)sulfonyl-N-(cyclopropylmethyl)piperidine-4-carboxamide (PubChem CID 24667159) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-(5-carbamoyl-1-methylpyrrol-3-yl)sulfonyl-N-(cyclopropylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-carbamoyl-1-methylpyrrol-3-yl)sulfonyl-N-(cyclopropylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24667159 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1-(5-carbamoyl-1-methylpyrrol-3-yl)sulfonyl-N-(cyclopropylmethyl)piperidine-4-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCC(C(=O)NCC3CC3)CC2)cc1C(N)=O |
| InChI | InChI=1S/C16H24N4O4S/c1-19-10-13(8-14(19)15(17)21)25(23,24)20-6-4-12(5-7-20)16(22)18-9-11-2-3-11/h8,10-12H,2-7,9H2,1H3,(H2,17,21)(H,18,22) |
| InChIKey | ZTRCALYAOXNNNN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |