C16H23N3O6S — CID 53004018
methyl 1-methyl-4-[2-(morpholine-4-carbonyl)pyrrolidin-1-yl]sulfonylpyrrole-2-carboxylate (PubChem CID 53004018) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is methyl 1-methyl-4-[2-(morpholine-4-carbonyl)pyrrolidin-1-yl]sulfonylpyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-4-[2-(morpholine-4-carbonyl)pyrrolidin-1-yl]sulfonylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 53004018 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 1-methyl-4-[2-(morpholine-4-carbonyl)pyrrolidin-1-yl]sulfonylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCCC2C(=O)N2CCOCC2)cn1C |
| InChI | InChI=1S/C16H23N3O6S/c1-17-11-12(10-14(17)16(21)24-2)26(22,23)19-5-3-4-13(19)15(20)18-6-8-25-9-7-18/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | JBVMWXAEQPQVCH-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |