C16H24N2O4S — CID 92722770
methyl 4-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-1-methylpyrrole-2-carboxylate (PubChem CID 92722770) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is methyl 4-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 92722770 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl 4-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]sulfonyl]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCC[C@H]3CCCC[C@@H]32)cn1C |
| InChI | InChI=1S/C16H24N2O4S/c1-17-11-13(10-15(17)16(19)22-2)23(20,21)18-9-5-7-12-6-3-4-8-14(12)18/h10-12,14H,3-9H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | DCPJRSRFUSBWKG-OCCSQVGLSA-N |
| XLogP | 2.15 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |