C21H28N4O6S — CID 37355621
4-[3-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one (PubChem CID 37355621) has the molecular formula C21H28N4O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is 4-[3-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one.
| Compound Name | 4-[3-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 37355621 |
| Molecular Formula | C21H28N4O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 4-[3-[4-(morpholine-4-carbonyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)N3CCC(C(=O)N4CCOCC4)CC3)c2)CCN1 |
| InChI | InChI=1S/C21H28N4O6S/c26-19-15-25(9-6-22-19)32(29,30)18-3-1-2-17(14-18)21(28)23-7-4-16(5-8-23)20(27)24-10-12-31-13-11-24/h1-3,14,16H,4-13,15H2,(H,22,26) |
| InChIKey | GCWNZPFPEBQWQU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |