C15H22ClN3O4S — CID 119402219
(3-morpholin-4-ylsulfonylphenyl)-piperazin-1-ylmethanone;hydrochloride (PubChem CID 119402219) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)-piperazin-1-ylmethanone;hydrochloride.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)-piperazin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119402219 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)-piperazin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1cccc(S(=O)(=O)N2CCOCC2)c1)N1CCNCC1 |
| InChI | InChI=1S/C15H21N3O4S.ClH/c19-15(17-6-4-16-5-7-17)13-2-1-3-14(12-13)23(20,21)18-8-10-22-11-9-18;/h1-3,12,16H,4-11H2;1H |
| InChIKey | MYDJTGAJZZEWRX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |