C11H14N2O4S — CID 18801880
3-piperazin-1-ylsulfonylbenzoic acid (PubChem CID 18801880) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-piperazin-1-ylsulfonylbenzoic acid.
| Compound Name | 3-piperazin-1-ylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 18801880 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-piperazin-1-ylsulfonylbenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C11H14N2O4S/c14-11(15)9-2-1-3-10(8-9)18(16,17)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2,(H,14,15) |
| InChIKey | CNNUKFLDDDZWKX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |