C12H16N2O4S — CID 61405271
3-(piperazin-1-ylsulfonylmethyl)benzoic acid (PubChem CID 61405271) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-(piperazin-1-ylsulfonylmethyl)benzoic acid.
| Compound Name | 3-(piperazin-1-ylsulfonylmethyl)benzoic acid |
|---|---|
| PubChem CID | 61405271 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(piperazin-1-ylsulfonylmethyl)benzoic acid |
| SMILES | O=C(O)c1cccc(CS(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C12H16N2O4S/c15-12(16)11-3-1-2-10(8-11)9-19(17,18)14-6-4-13-5-7-14/h1-3,8,13H,4-7,9H2,(H,15,16) |
| InChIKey | JWYNWGLLODAPJV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |