C12H16N2O4S — CID 61405195
3-(1,4-diazepan-1-ylsulfonyl)benzoic acid (PubChem CID 61405195) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-ylsulfonyl)benzoic acid.
| Compound Name | 3-(1,4-diazepan-1-ylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 61405195 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(1,4-diazepan-1-ylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2CCCNCC2)c1 |
| InChI | InChI=1S/C12H16N2O4S/c15-12(16)10-3-1-4-11(9-10)19(17,18)14-7-2-5-13-6-8-14/h1,3-4,9,13H,2,5-8H2,(H,15,16) |
| InChIKey | WGBJANNLJXYEPC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |